C7H9N — CID 23381921
1-methyl-2,5-dimethylidenepyrrole (PubChem CID 23381921) has the molecular formula C7H9N and a molecular weight of 107.16 g/mol. Its IUPAC name is 1-methyl-2,5-dimethylidenepyrrole.
| Compound Name | 1-methyl-2,5-dimethylidenepyrrole |
|---|---|
| PubChem CID | 23381921 |
| Molecular Formula | C7H9N |
| Molecular Weight | 107.16 g/mol |
| Exact Mass | 107.07 |
| IUPAC Name | 1-methyl-2,5-dimethylidenepyrrole |
| SMILES | C=c1ccc(=C)n1C |
| InChI | InChI=1S/C7H9N/c1-6-4-5-7(2)8(6)3/h4-5H,1-2H2,3H3 |
| InChIKey | WZRMCSOGHQLRCW-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 107.16 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |