C8H12FN — CID 123814892
3-fluoro-N,N-dimethylhexa-1,3,5-trien-2-amine (PubChem CID 123814892) has the molecular formula C8H12FN and a molecular weight of 141.19 g/mol. Its IUPAC name is 3-fluoro-N,N-dimethylhexa-1,3,5-trien-2-amine.
| Compound Name | 3-fluoro-N,N-dimethylhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 123814892 |
| Molecular Formula | C8H12FN |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | 3-fluoro-N,N-dimethylhexa-1,3,5-trien-2-amine |
| SMILES | C=CC=C(F)C(=C)N(C)C |
| InChI | InChI=1S/C8H12FN/c1-5-6-8(9)7(2)10(3)4/h5-6H,1-2H2,3-4H3 |
| InChIKey | YYORHRRISCMSSK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|