C11H22NO4P — CID 102525241
6-[ethyl(prop-2-enoyl)amino]hexylphosphonic acid (PubChem CID 102525241) has the molecular formula C11H22NO4P and a molecular weight of 263.27 g/mol. Its IUPAC name is 6-[ethyl(prop-2-enoyl)amino]hexylphosphonic acid.
| Compound Name | 6-[ethyl(prop-2-enoyl)amino]hexylphosphonic acid |
|---|---|
| PubChem CID | 102525241 |
| Molecular Formula | C11H22NO4P |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 6-[ethyl(prop-2-enoyl)amino]hexylphosphonic acid |
| SMILES | C=CC(=O)N(CC)CCCCCCP(=O)(O)O |
| InChI | InChI=1S/C11H22NO4P/c1-3-11(13)12(4-2)9-7-5-6-8-10-17(14,15)16/h3H,1,4-10H2,2H3,(H2,14,15,16) |
| InChIKey | YXSSNCGPOLEHKR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|