C24H38N4O4 — CID 135296269
(2Z,4E)-N'-ethyl-N'-[3-[ethyl(prop-2-enoyl)amino]propyl]-N-methyl-N-[3-[methyl(prop-2-enoyl)amino]propyl]hexa-2,4-dienediamide (PubChem CID 135296269) has the molecular formula C24H38N4O4 and a molecular weight of 446.59 g/mol. Its IUPAC name is (2Z,4E)-N'-ethyl-N'-[3-[ethyl(prop-2-enoyl)amino]propyl]-N-methyl-N-[3-[methyl(prop-2-enoyl)amino]propyl]hexa-2,4-dienediamide.
| Compound Name | (2Z,4E)-N'-ethyl-N'-[3-[ethyl(prop-2-enoyl)amino]propyl]-N-methyl-N-[3-[methyl(prop-2-enoyl)amino]propyl]hexa-2,4-dienediamide |
|---|---|
| PubChem CID | 135296269 |
| Molecular Formula | C24H38N4O4 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | (2Z,4E)-N'-ethyl-N'-[3-[ethyl(prop-2-enoyl)amino]propyl]-N-methyl-N-[3-[methyl(prop-2-enoyl)amino]propyl]hexa-2,4-dienediamide |
| SMILES | C=CC(=O)N(C)CCCN(C)C(=O)/C=C\C=C\C(=O)N(CC)CCCN(CC)C(=O)C=C |
| InChI | InChI=1S/C24H38N4O4/c1-7-21(29)25(5)17-13-18-26(6)23(31)15-11-12-16-24(32)28(10-4)20-14-19-27(9-3)22(30)8-2/h7-8,11-12,15-16H,1-2,9-10,13-14,17-20H2,3-6H3/b15-11-,16-12+ |
| InChIKey | GQSLMLIQOJZJMV-UKVBVZPVSA-N |
| XLogP | 1.86 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|