C38H63N5O5 — CID 131967207
(2E,4E)-N-[3-[[(2E,4E)-6-[ethyl-[3-[ethyl(prop-2-enoyl)amino]propyl]amino]-2-methyl-6-oxohexa-2,4-dienoyl]-methylamino]propyl]-N'-heptyl-N,N',2,5-tetramethylhexa-2,4-dienediamide (PubChem CID 131967207) has the molecular formula C38H63N5O5 and a molecular weight of 669.95 g/mol. Its IUPAC name is (2E,4E)-N-[3-[[(2E,4E)-6-[ethyl-[3-[ethyl(prop-2-enoyl)amino]propyl]amino]-2-methyl-6-oxohexa-2,4-dienoyl]-methylamino]propyl]-N'-heptyl-N,N',2,5-tetramethylhexa-2,4-dienediamide.
| Compound Name | (2E,4E)-N-[3-[[(2E,4E)-6-[ethyl-[3-[ethyl(prop-2-enoyl)amino]propyl]amino]-2-methyl-6-oxohexa-2,4-dienoyl]-methylamino]propyl]-N'-heptyl-N,N',2,5-tetramethylhexa-2,4-dienediamide |
|---|---|
| PubChem CID | 131967207 |
| Molecular Formula | C38H63N5O5 |
| Molecular Weight | 669.95 g/mol |
| Exact Mass | 669.48 |
| IUPAC Name | (2E,4E)-N-[3-[[(2E,4E)-6-[ethyl-[3-[ethyl(prop-2-enoyl)amino]propyl]amino]-2-methyl-6-oxohexa-2,4-dienoyl]-methylamino]propyl]-N'-heptyl-N,N',2,5-tetramethylhexa-2,4-dienediamide |
| SMILES | C=CC(=O)N(CC)CCCN(CC)C(=O)/C=C/C=C(\C)C(=O)N(C)CCCN(C)C(=O)/C(C)=C/C=C(\C)C(=O)N(C)CCCCCCC |
| InChI | InChI=1S/C38H63N5O5/c1-11-15-16-17-18-26-39(8)37(47)32(6)24-25-33(7)38(48)41(10)28-20-27-40(9)36(46)31(5)22-19-23-35(45)43(14-4)30-21-29-42(13-3)34(44)12-2/h12,19,22-25H,2,11,13-18,20-21,26-30H2,1,3-10H3/b23-19+,31-22+,32-24+,33-25+ |
| InChIKey | KYQWNYMRCPVSLH-WLMZZTLHSA-N |
| XLogP | 5.39 |
| TPSA | 101.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.95 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|