C17H33NO6 — CID 18649780
N-octyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]prop-2-enamide (PubChem CID 18649780) has the molecular formula C17H33NO6 and a molecular weight of 347.45 g/mol. Its IUPAC name is N-octyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]prop-2-enamide.
| Compound Name | N-octyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]prop-2-enamide |
|---|---|
| PubChem CID | 18649780 |
| Molecular Formula | C17H33NO6 |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | N-octyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]prop-2-enamide |
| SMILES | C=CC(=O)N(CCCCCCCC)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C17H33NO6/c1-3-5-6-7-8-9-10-18(15(22)4-2)11-13(20)16(23)17(24)14(21)12-19/h4,13-14,16-17,19-21,23-24H,2-3,5-12H2,1H3/t13-,14+,16+,17+/m0/s1 |
| InChIKey | OMXZLUSCWZGFRO-XOSAIJSUSA-N |
| XLogP | -0.20 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|