C16H33NO7 — CID 118130603
[octyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino] acetate (PubChem CID 118130603) has the molecular formula C16H33NO7 and a molecular weight of 351.44 g/mol. Its IUPAC name is [octyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino] acetate.
| Compound Name | [octyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino] acetate |
|---|---|
| PubChem CID | 118130603 |
| Molecular Formula | C16H33NO7 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | [octyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino] acetate |
| SMILES | CCCCCCCCN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)OC(C)=O |
| InChI | InChI=1S/C16H33NO7/c1-3-4-5-6-7-8-9-17(24-12(2)19)10-13(20)15(22)16(23)14(21)11-18/h13-16,18,20-23H,3-11H2,1-2H3/t13-,14+,15+,16+/m0/s1 |
| InChIKey | YSVDJYZJWJUAIK-ZJIFWQFVSA-N |
| XLogP | -0.44 |
| TPSA | 130.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|