C18H37NO7 — CID 118130604
[octyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino] butanoate (PubChem CID 118130604) has the molecular formula C18H37NO7 and a molecular weight of 379.49 g/mol. Its IUPAC name is [octyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino] butanoate.
| Compound Name | [octyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino] butanoate |
|---|---|
| PubChem CID | 118130604 |
| Molecular Formula | C18H37NO7 |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | [octyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino] butanoate |
| SMILES | CCCCCCCCN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)OC(=O)CCC |
| InChI | InChI=1S/C18H37NO7/c1-3-5-6-7-8-9-11-19(26-16(23)10-4-2)12-14(21)17(24)18(25)15(22)13-20/h14-15,17-18,20-22,24-25H,3-13H2,1-2H3/t14-,15+,17+,18+/m0/s1 |
| InChIKey | BRMFEHXRHLRYTM-BURFUSLBSA-N |
| XLogP | 0.34 |
| TPSA | 130.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|