C28H55NO7 — CID 54303731
N-(3-methoxypropyl)-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]octadec-9-enamide (PubChem CID 54303731) has the molecular formula C28H55NO7 and a molecular weight of 517.75 g/mol. Its IUPAC name is N-(3-methoxypropyl)-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]octadec-9-enamide.
| Compound Name | N-(3-methoxypropyl)-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]octadec-9-enamide |
|---|---|
| PubChem CID | 54303731 |
| Molecular Formula | C28H55NO7 |
| Molecular Weight | 517.75 g/mol |
| Exact Mass | 517.40 |
| IUPAC Name | N-(3-methoxypropyl)-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]octadec-9-enamide |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)N(CCCOC)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C28H55NO7/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-26(33)29(20-18-21-36-2)22-24(31)27(34)28(35)25(32)23-30/h10-11,24-25,27-28,30-32,34-35H,3-9,12-23H2,1-2H3/t24-,25+,27+,28+/m0/s1 |
| InChIKey | SGADUPUGVMLBQZ-PAVXMLEDSA-N |
| XLogP | 3.32 |
| TPSA | 130.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.75 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|