C14H27N3O2 — CID 170208483
(2S)-2-[3-[ethyl(prop-2-enoyl)amino]propyl-methylamino]-3-methylbutanamide (PubChem CID 170208483) has the molecular formula C14H27N3O2 and a molecular weight of 269.39 g/mol. Its IUPAC name is (2S)-2-[3-[ethyl(prop-2-enoyl)amino]propyl-methylamino]-3-methylbutanamide.
| Compound Name | (2S)-2-[3-[ethyl(prop-2-enoyl)amino]propyl-methylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 170208483 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | (2S)-2-[3-[ethyl(prop-2-enoyl)amino]propyl-methylamino]-3-methylbutanamide |
| SMILES | C=CC(=O)N(CC)CCCN(C)[C@H](C(N)=O)C(C)C |
| InChI | InChI=1S/C14H27N3O2/c1-6-12(18)17(7-2)10-8-9-16(5)13(11(3)4)14(15)19/h6,11,13H,1,7-10H2,2-5H3,(H2,15,19)/t13-/m0/s1 |
| InChIKey | YPFAOUWQGPBCSB-ZDUSSCGKSA-N |
| XLogP | 0.85 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|