C11H25N3O — CID 43116469
2-[3-aminopropyl(methyl)amino]-N,N-diethylpropanamide (PubChem CID 43116469) has the molecular formula C11H25N3O and a molecular weight of 215.34 g/mol. Its IUPAC name is 2-[3-aminopropyl(methyl)amino]-N,N-diethylpropanamide.
| Compound Name | 2-[3-aminopropyl(methyl)amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 43116469 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | 2-[3-aminopropyl(methyl)amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)N(C)CCCN |
| InChI | InChI=1S/C11H25N3O/c1-5-14(6-2)11(15)10(3)13(4)9-7-8-12/h10H,5-9,12H2,1-4H3 |
| InChIKey | ULZXPQFIRFXUAR-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |