C10H22N2O2 — CID 62020446
N,N-diethyl-2-[2-hydroxyethyl(methyl)amino]propanamide (PubChem CID 62020446) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is N,N-diethyl-2-[2-hydroxyethyl(methyl)amino]propanamide.
| Compound Name | N,N-diethyl-2-[2-hydroxyethyl(methyl)amino]propanamide |
|---|---|
| PubChem CID | 62020446 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | N,N-diethyl-2-[2-hydroxyethyl(methyl)amino]propanamide |
| SMILES | CCN(CC)C(=O)C(C)N(C)CCO |
| InChI | InChI=1S/C10H22N2O2/c1-5-12(6-2)10(14)9(3)11(4)7-8-13/h9,13H,5-8H2,1-4H3 |
| InChIKey | AKWBMPJUWVKNHH-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |