ethyl(2-hydroxyethyl)carbamic acid

C5H11NO3 — CID 23202017

IUPACethyl(2-hydroxyethyl)carbamic acid
SMILESCCN(CCO)C(=O)O
InChIInChI=1S/C5H11NO3/c1-2-6(3-4-7)5(8)9/h7H,2-4H2,1H3,(H,8,9)
InChIKeyKVADBZXOFYIEPQ-UHFFFAOYSA-N
MW133.15 g/mol
LogP-0.02
Rot. Bonds3

About ethyl(2-hydroxyethyl)carbamic acid

ethyl(2-hydroxyethyl)carbamic acid (PubChem CID 23202017) has the molecular formula C5H11NO3 and a molecular weight of 133.15 g/mol. Its IUPAC name is ethyl(2-hydroxyethyl)carbamic acid.

Molecular Properties

Compound Nameethyl(2-hydroxyethyl)carbamic acid
PubChem CID23202017
Molecular FormulaC5H11NO3
Molecular Weight133.15 g/mol
Exact Mass133.07
IUPAC Nameethyl(2-hydroxyethyl)carbamic acid
SMILESCCN(CCO)C(=O)O
InChIInChI=1S/C5H11NO3/c1-2-6(3-4-7)5(8)9/h7H,2-4H2,1H3,(H,8,9)
InChIKeyKVADBZXOFYIEPQ-UHFFFAOYSA-N
XLogP-0.02
TPSA60.77 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500133.15
LogP ≤ 5-0.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze ethyl(2-hydroxyethyl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl(2-hydroxyethyl)carbamic acid?
The IUPAC name of ethyl(2-hydroxyethyl)carbamic acid (CID 23202017) is ethyl(2-hydroxyethyl)carbamic acid.
What is the SMILES notation for ethyl(2-hydroxyethyl)carbamic acid?
The canonical SMILES for ethyl(2-hydroxyethyl)carbamic acid is CCN(CCO)C(=O)O.
What is the InChIKey of ethyl(2-hydroxyethyl)carbamic acid?
The InChIKey is KVADBZXOFYIEPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO3/c1-2-6(3-4-7)5(8)9/h7H,2-4H2,1H3,(H,8,9).
What are the key properties of ethyl(2-hydroxyethyl)carbamic acid?
ethyl(2-hydroxyethyl)carbamic acid has a molecular weight of 133.15 g/mol, XLogP of -0.02, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(2-hydroxyethyl)carbamic acid is sourced from PubChem (CID 23202017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).