C11H10F5NO2 — CID 60722923
N-ethyl-2,3,4,5,6-pentafluoro-N-(2-hydroxyethyl)benzamide (PubChem CID 60722923) has the molecular formula C11H10F5NO2 and a molecular weight of 283.20 g/mol. Its IUPAC name is N-ethyl-2,3,4,5,6-pentafluoro-N-(2-hydroxyethyl)benzamide.
| Compound Name | N-ethyl-2,3,4,5,6-pentafluoro-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 60722923 |
| Molecular Formula | C11H10F5NO2 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | N-ethyl-2,3,4,5,6-pentafluoro-N-(2-hydroxyethyl)benzamide |
| SMILES | CCN(CCO)C(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H10F5NO2/c1-2-17(3-4-18)11(19)5-6(12)8(14)10(16)9(15)7(5)13/h18H,2-4H2,1H3 |
| InChIKey | YKFSVJDFCJQYNV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|