C12H12F5NO2 — CID 43608029
2,3,4,5,6-pentafluoro-N-(2-hydroxyethyl)-N-propan-2-ylbenzamide (PubChem CID 43608029) has the molecular formula C12H12F5NO2 and a molecular weight of 297.22 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(2-hydroxyethyl)-N-propan-2-ylbenzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(2-hydroxyethyl)-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 43608029 |
| Molecular Formula | C12H12F5NO2 |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(2-hydroxyethyl)-N-propan-2-ylbenzamide |
| SMILES | CC(C)N(CCO)C(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H12F5NO2/c1-5(2)18(3-4-19)12(20)6-7(13)9(15)11(17)10(16)8(6)14/h5,19H,3-4H2,1-2H3 |
| InChIKey | SISURGWOGNWRTF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|