C13H14F5NO2 — CID 61040258
2,3,4,5,6-pentafluoro-N-(3-hydroxypropyl)-N-propan-2-ylbenzamide (PubChem CID 61040258) has the molecular formula C13H14F5NO2 and a molecular weight of 311.25 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(3-hydroxypropyl)-N-propan-2-ylbenzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(3-hydroxypropyl)-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 61040258 |
| Molecular Formula | C13H14F5NO2 |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(3-hydroxypropyl)-N-propan-2-ylbenzamide |
| SMILES | CC(C)N(CCCO)C(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H14F5NO2/c1-6(2)19(4-3-5-20)13(21)7-8(14)10(16)12(18)11(17)9(7)15/h6,20H,3-5H2,1-2H3 |
| InChIKey | QGHFZZGDGKXSQB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|