C7H16N2O2 — CID 61040269
1-(3-hydroxypropyl)-1-propan-2-ylurea (PubChem CID 61040269) has the molecular formula C7H16N2O2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-1-propan-2-ylurea.
| Compound Name | 1-(3-hydroxypropyl)-1-propan-2-ylurea |
|---|---|
| PubChem CID | 61040269 |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | 1-(3-hydroxypropyl)-1-propan-2-ylurea |
| SMILES | CC(C)N(CCCO)C(N)=O |
| InChI | InChI=1S/C7H16N2O2/c1-6(2)9(7(8)11)4-3-5-10/h6,10H,3-5H2,1-2H3,(H2,8,11) |
| InChIKey | GWPCLXYOPZOOIZ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |