C12H24N2O4 — CID 55007333
3-[[3-hydroxypropyl(propan-2-yl)carbamoyl]-methylamino]-2-methylpropanoic acid (PubChem CID 55007333) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is 3-[[3-hydroxypropyl(propan-2-yl)carbamoyl]-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[[3-hydroxypropyl(propan-2-yl)carbamoyl]-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 55007333 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 3-[[3-hydroxypropyl(propan-2-yl)carbamoyl]-methylamino]-2-methylpropanoic acid |
| SMILES | CC(CN(C)C(=O)N(CCCO)C(C)C)C(=O)O |
| InChI | InChI=1S/C12H24N2O4/c1-9(2)14(6-5-7-15)12(18)13(4)8-10(3)11(16)17/h9-10,15H,5-8H2,1-4H3,(H,16,17) |
| InChIKey | FEZMUESWERWKSW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |