C11H23NO5S — CID 82326460
3-[butylsulfonyl(3-hydroxypropyl)amino]-2-methylpropanoic acid (PubChem CID 82326460) has the molecular formula C11H23NO5S and a molecular weight of 281.37 g/mol. Its IUPAC name is 3-[butylsulfonyl(3-hydroxypropyl)amino]-2-methylpropanoic acid.
| Compound Name | 3-[butylsulfonyl(3-hydroxypropyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 82326460 |
| Molecular Formula | C11H23NO5S |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 3-[butylsulfonyl(3-hydroxypropyl)amino]-2-methylpropanoic acid |
| SMILES | CCCCS(=O)(=O)N(CCCO)CC(C)C(=O)O |
| InChI | InChI=1S/C11H23NO5S/c1-3-4-8-18(16,17)12(6-5-7-13)9-10(2)11(14)15/h10,13H,3-9H2,1-2H3,(H,14,15) |
| InChIKey | RFCMISCBRVTDDK-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |