C13H29NO3S — CID 107871668
3-hydroxy-N,N-bis(3-methylbutyl)propane-1-sulfonamide (PubChem CID 107871668) has the molecular formula C13H29NO3S and a molecular weight of 279.45 g/mol. Its IUPAC name is 3-hydroxy-N,N-bis(3-methylbutyl)propane-1-sulfonamide.
| Compound Name | 3-hydroxy-N,N-bis(3-methylbutyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 107871668 |
| Molecular Formula | C13H29NO3S |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 3-hydroxy-N,N-bis(3-methylbutyl)propane-1-sulfonamide |
| SMILES | CC(C)CCN(CCC(C)C)S(=O)(=O)CCCO |
| InChI | InChI=1S/C13H29NO3S/c1-12(2)6-8-14(9-7-13(3)4)18(16,17)11-5-10-15/h12-13,15H,5-11H2,1-4H3 |
| InChIKey | YKTXWSLDAUUYDY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |