C10H22F2N2O3S — CID 107480963
N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-3-(propan-2-ylamino)propane-1-sulfonamide (PubChem CID 107480963) has the molecular formula C10H22F2N2O3S and a molecular weight of 288.36 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-3-(propan-2-ylamino)propane-1-sulfonamide.
| Compound Name | N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-3-(propan-2-ylamino)propane-1-sulfonamide |
|---|---|
| PubChem CID | 107480963 |
| Molecular Formula | C10H22F2N2O3S |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-3-(propan-2-ylamino)propane-1-sulfonamide |
| SMILES | CC(C)NCCCS(=O)(=O)N(CCO)CC(F)F |
| InChI | InChI=1S/C10H22F2N2O3S/c1-9(2)13-4-3-7-18(16,17)14(5-6-15)8-10(11)12/h9-10,13,15H,3-8H2,1-2H3 |
| InChIKey | WPHJVZBQYRKKQM-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|