About methyl 4-[2,2-difluoroethyl(2-hydroxyethyl)sulfamoyl]butanoate
methyl 4-[2,2-difluoroethyl(2-hydroxyethyl)sulfamoyl]butanoate (PubChem CID 107478984) has the molecular formula C9H17F2NO5S
and a molecular weight of 289.30 g/mol. Its IUPAC name is methyl 4-[2,2-difluoroethyl(2-hydroxyethyl)sulfamoyl]butanoate.
Analyze methyl 4-[2,2-difluoroethyl(2-hydroxyethyl)sulfamoyl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[2,2-difluoroethyl(2-hydroxyethyl)sulfamoyl]butanoate?
The IUPAC name of methyl 4-[2,2-difluoroethyl(2-hydroxyethyl)sulfamoyl]butanoate (CID 107478984) is methyl 4-[2,2-difluoroethyl(2-hydroxyethyl)sulfamoyl]butanoate.
What is the SMILES notation for methyl 4-[2,2-difluoroethyl(2-hydroxyethyl)sulfamoyl]butanoate?
The canonical SMILES for methyl 4-[2,2-difluoroethyl(2-hydroxyethyl)sulfamoyl]butanoate is COC(=O)CCCS(=O)(=O)N(CCO)CC(F)F.
What is the InChIKey of methyl 4-[2,2-difluoroethyl(2-hydroxyethyl)sulfamoyl]butanoate?
The InChIKey is LKQMQMVCUBPBAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2NO5S/c1-17-9(14)3-2-6-18(15,16)12(4-5-13)7-8(10)11/h8,13H,2-7H2,1H3.
What are the key properties of methyl 4-[2,2-difluoroethyl(2-hydroxyethyl)sulfamoyl]butanoate?
methyl 4-[2,2-difluoroethyl(2-hydroxyethyl)sulfamoyl]butanoate has a molecular weight of 289.30 g/mol, XLogP of -0.17, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2,2-difluoroethyl(2-hydroxyethyl)sulfamoyl]butanoate is sourced from PubChem (CID 107478984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).