C10H24N2O2S — CID 52565324
3-methyl-1-[3-methylbutyl(sulfamoyl)amino]butane (PubChem CID 52565324) has the molecular formula C10H24N2O2S and a molecular weight of 236.38 g/mol. Its IUPAC name is 3-methyl-1-[3-methylbutyl(sulfamoyl)amino]butane.
| Compound Name | 3-methyl-1-[3-methylbutyl(sulfamoyl)amino]butane |
|---|---|
| PubChem CID | 52565324 |
| Molecular Formula | C10H24N2O2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 3-methyl-1-[3-methylbutyl(sulfamoyl)amino]butane |
| SMILES | CC(C)CCN(CCC(C)C)S(N)(=O)=O |
| InChI | InChI=1S/C10H24N2O2S/c1-9(2)5-7-12(15(11,13)14)8-6-10(3)4/h9-10H,5-8H2,1-4H3,(H2,11,13,14) |
| InChIKey | MMBHEGLMRRKVGO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |