C16H36ClN3O2S — CID 119970554
1-amino-4-[bis(3-methylbutyl)sulfamoylamino]cyclohexane;hydrochloride (PubChem CID 119970554) has the molecular formula C16H36ClN3O2S and a molecular weight of 370.00 g/mol. Its IUPAC name is 1-amino-4-[bis(3-methylbutyl)sulfamoylamino]cyclohexane;hydrochloride.
| Compound Name | 1-amino-4-[bis(3-methylbutyl)sulfamoylamino]cyclohexane;hydrochloride |
|---|---|
| PubChem CID | 119970554 |
| Molecular Formula | C16H36ClN3O2S |
| Molecular Weight | 370.00 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 1-amino-4-[bis(3-methylbutyl)sulfamoylamino]cyclohexane;hydrochloride |
| SMILES | CC(C)CCN(CCC(C)C)S(=O)(=O)NC1CCC(N)CC1.Cl |
| InChI | InChI=1S/C16H35N3O2S.ClH/c1-13(2)9-11-19(12-10-14(3)4)22(20,21)18-16-7-5-15(17)6-8-16;/h13-16,18H,5-12,17H2,1-4H3;1H |
| InChIKey | QYNRPQQWYPJKSA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.00 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |