C14H32N4O4S2 — CID 31065973
1,4-bis(diethylsulfamoylamino)cyclohexane (PubChem CID 31065973) has the molecular formula C14H32N4O4S2 and a molecular weight of 384.57 g/mol. Its IUPAC name is 1,4-bis(diethylsulfamoylamino)cyclohexane.
| Compound Name | 1,4-bis(diethylsulfamoylamino)cyclohexane |
|---|---|
| PubChem CID | 31065973 |
| Molecular Formula | C14H32N4O4S2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 1,4-bis(diethylsulfamoylamino)cyclohexane |
| SMILES | CCN(CC)S(=O)(=O)NC1CCC(NS(=O)(=O)N(CC)CC)CC1 |
| InChI | InChI=1S/C14H32N4O4S2/c1-5-17(6-2)23(19,20)15-13-9-11-14(12-10-13)16-24(21,22)18(7-3)8-4/h13-16H,5-12H2,1-4H3 |
| InChIKey | CFSDBFJMDOJVBA-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |