About 2-N-[bis(3-methylbutyl)sulfamoyl]-2-N-methylpropane-1,2-diamine;hydrochloride
2-N-[bis(3-methylbutyl)sulfamoyl]-2-N-methylpropane-1,2-diamine;hydrochloride (PubChem CID 119982466) has the molecular formula C14H34ClN3O2S
and a molecular weight of 343.97 g/mol. Its IUPAC name is 2-N-[bis(3-methylbutyl)sulfamoyl]-2-N-methylpropane-1,2-diamine;hydrochloride.
Molecular Properties
| Compound Name | 2-N-[bis(3-methylbutyl)sulfamoyl]-2-N-methylpropane-1,2-diamine;hydrochloride |
| PubChem CID | 119982466 |
| Molecular Formula | C14H34ClN3O2S |
| Molecular Weight | 343.97 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 2-N-[bis(3-methylbutyl)sulfamoyl]-2-N-methylpropane-1,2-diamine;hydrochloride |
| SMILES | CC(C)CCN(CCC(C)C)S(=O)(=O)N(C)C(C)CN.Cl |
| InChI | InChI=1S/C14H33N3O2S.ClH/c1-12(2)7-9-17(10-8-13(3)4)20(18,19)16(6)14(5)11-15;/h12-14H,7-11,15H2,1-6H3;1H |
| InChIKey | VPJBHBXNHBYXKT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.97 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N-[bis(3-methylbutyl)sulfamoyl]-2-N-methylpropane-1,2-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[bis(3-methylbutyl)sulfamoyl]-2-N-methylpropane-1,2-diamine;hydrochloride?
The IUPAC name of 2-N-[bis(3-methylbutyl)sulfamoyl]-2-N-methylpropane-1,2-diamine;hydrochloride (CID 119982466) is 2-N-[bis(3-methylbutyl)sulfamoyl]-2-N-methylpropane-1,2-diamine;hydrochloride.
What is the SMILES notation for 2-N-[bis(3-methylbutyl)sulfamoyl]-2-N-methylpropane-1,2-diamine;hydrochloride?
The canonical SMILES for 2-N-[bis(3-methylbutyl)sulfamoyl]-2-N-methylpropane-1,2-diamine;hydrochloride is CC(C)CCN(CCC(C)C)S(=O)(=O)N(C)C(C)CN.Cl.
What is the InChIKey of 2-N-[bis(3-methylbutyl)sulfamoyl]-2-N-methylpropane-1,2-diamine;hydrochloride?
The InChIKey is VPJBHBXNHBYXKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H33N3O2S.ClH/c1-12(2)7-9-17(10-8-13(3)4)20(18,19)16(6)14(5)11-15;/h12-14H,7-11,15H2,1-6H3;1H.
What are the key properties of 2-N-[bis(3-methylbutyl)sulfamoyl]-2-N-methylpropane-1,2-diamine;hydrochloride?
2-N-[bis(3-methylbutyl)sulfamoyl]-2-N-methylpropane-1,2-diamine;hydrochloride has a molecular weight of 343.97 g/mol, XLogP of 2.33, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[bis(3-methylbutyl)sulfamoyl]-2-N-methylpropane-1,2-diamine;hydrochloride is sourced from PubChem (CID 119982466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).