C12H26ClN3O2 — CID 119582150
N-[2-[1-aminopropan-2-yl(methyl)amino]-2-oxoethyl]-4-methylpentanamide;hydrochloride (PubChem CID 119582150) has the molecular formula C12H26ClN3O2 and a molecular weight of 279.81 g/mol. Its IUPAC name is N-[2-[1-aminopropan-2-yl(methyl)amino]-2-oxoethyl]-4-methylpentanamide;hydrochloride.
| Compound Name | N-[2-[1-aminopropan-2-yl(methyl)amino]-2-oxoethyl]-4-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119582150 |
| Molecular Formula | C12H26ClN3O2 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N-[2-[1-aminopropan-2-yl(methyl)amino]-2-oxoethyl]-4-methylpentanamide;hydrochloride |
| SMILES | CC(C)CCC(=O)NCC(=O)N(C)C(C)CN.Cl |
| InChI | InChI=1S/C12H25N3O2.ClH/c1-9(2)5-6-11(16)14-8-12(17)15(4)10(3)7-13;/h9-10H,5-8,13H2,1-4H3,(H,14,16);1H |
| InChIKey | KWJPRWPQMIYNIR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |