C11H24N2O — CID 63225605
N-(4-aminobutan-2-yl)-N,4-dimethylpentanamide (PubChem CID 63225605) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is N-(4-aminobutan-2-yl)-N,4-dimethylpentanamide.
| Compound Name | N-(4-aminobutan-2-yl)-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 63225605 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | N-(4-aminobutan-2-yl)-N,4-dimethylpentanamide |
| SMILES | CC(C)CCC(=O)N(C)C(C)CCN |
| InChI | InChI=1S/C11H24N2O/c1-9(2)5-6-11(14)13(4)10(3)7-8-12/h9-10H,5-8,12H2,1-4H3 |
| InChIKey | LBJIBYRZPOBCSD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |