C15H31NO — CID 170241261
N,9-dimethyl-N-propan-2-yldecanamide (PubChem CID 170241261) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is N,9-dimethyl-N-propan-2-yldecanamide.
| Compound Name | N,9-dimethyl-N-propan-2-yldecanamide |
|---|---|
| PubChem CID | 170241261 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | N,9-dimethyl-N-propan-2-yldecanamide |
| SMILES | CC(C)CCCCCCCC(=O)N(C)C(C)C |
| InChI | InChI=1S/C15H31NO/c1-13(2)11-9-7-6-8-10-12-15(17)16(5)14(3)4/h13-14H,6-12H2,1-5H3 |
| InChIKey | LATNMBHQTWXRTL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|