C23H49N3O2 — CID 175917154
16-methylheptadecanoic acid;1,1,3,3-tetramethylguanidine (PubChem CID 175917154) has the molecular formula C23H49N3O2 and a molecular weight of 399.66 g/mol. Its IUPAC name is 16-methylheptadecanoic acid;1,1,3,3-tetramethylguanidine.
| Compound Name | 16-methylheptadecanoic acid;1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 175917154 |
| Molecular Formula | C23H49N3O2 |
| Molecular Weight | 399.66 g/mol |
| Exact Mass | 399.38 |
| IUPAC Name | 16-methylheptadecanoic acid;1,1,3,3-tetramethylguanidine |
| SMILES | CC(C)CCCCCCCCCCCCCCC(=O)O.[H]N=C(N(C)C)N(C)C |
| InChI | InChI=1S/C18H36O2.C5H13N3/c1-17(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(19)20;1-7(2)5(6)8(3)4/h17H,3-16H2,1-2H3,(H,19,20);6H,1-4H3 |
| InChIKey | YOVXJJQOCANFAY-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.66 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|