C12H25NO — CID 147805766
N,5-dimethyl-N-(2-methylpropyl)hexanamide (PubChem CID 147805766) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is N,5-dimethyl-N-(2-methylpropyl)hexanamide.
| Compound Name | N,5-dimethyl-N-(2-methylpropyl)hexanamide |
|---|---|
| PubChem CID | 147805766 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | N,5-dimethyl-N-(2-methylpropyl)hexanamide |
| SMILES | CC(C)CCCC(=O)N(C)CC(C)C |
| InChI | InChI=1S/C12H25NO/c1-10(2)7-6-8-12(14)13(5)9-11(3)4/h10-11H,6-9H2,1-5H3 |
| InChIKey | HMKBAHIONDMEHJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |