C10H19NO2 — CID 122207721
N-acetyl-N,5-dimethylhexanamide (PubChem CID 122207721) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is N-acetyl-N,5-dimethylhexanamide.
| Compound Name | N-acetyl-N,5-dimethylhexanamide |
|---|---|
| PubChem CID | 122207721 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | N-acetyl-N,5-dimethylhexanamide |
| SMILES | CC(=O)N(C)C(=O)CCCC(C)C |
| InChI | InChI=1S/C10H19NO2/c1-8(2)6-5-7-10(13)11(4)9(3)12/h8H,5-7H2,1-4H3 |
| InChIKey | JXEIPGUGNYGIHU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |