About N-acetyl-N,N'-dimethyl-N'-nonanoyloxamide
N-acetyl-N,N'-dimethyl-N'-nonanoyloxamide (PubChem CID 54021759) has the molecular formula C15H26N2O4
and a molecular weight of 298.38 g/mol. Its IUPAC name is N-acetyl-N,N'-dimethyl-N'-nonanoyloxamide.
Molecular Properties
| Compound Name | N-acetyl-N,N'-dimethyl-N'-nonanoyloxamide |
| PubChem CID | 54021759 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | N-acetyl-N,N'-dimethyl-N'-nonanoyloxamide |
| SMILES | CCCCCCCCC(=O)N(C)C(=O)C(=O)N(C)C(C)=O |
| InChI | InChI=1S/C15H26N2O4/c1-5-6-7-8-9-10-11-13(19)17(4)15(21)14(20)16(3)12(2)18/h5-11H2,1-4H3 |
| InChIKey | KZKIBDLGURRUHJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-acetyl-N,N'-dimethyl-N'-nonanoyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetyl-N,N'-dimethyl-N'-nonanoyloxamide?
The IUPAC name of N-acetyl-N,N'-dimethyl-N'-nonanoyloxamide (CID 54021759) is N-acetyl-N,N'-dimethyl-N'-nonanoyloxamide.
What is the SMILES notation for N-acetyl-N,N'-dimethyl-N'-nonanoyloxamide?
The canonical SMILES for N-acetyl-N,N'-dimethyl-N'-nonanoyloxamide is CCCCCCCCC(=O)N(C)C(=O)C(=O)N(C)C(C)=O.
What is the InChIKey of N-acetyl-N,N'-dimethyl-N'-nonanoyloxamide?
The InChIKey is KZKIBDLGURRUHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O4/c1-5-6-7-8-9-10-11-13(19)17(4)15(21)14(20)16(3)12(2)18/h5-11H2,1-4H3.
What are the key properties of N-acetyl-N,N'-dimethyl-N'-nonanoyloxamide?
N-acetyl-N,N'-dimethyl-N'-nonanoyloxamide has a molecular weight of 298.38 g/mol, XLogP of 1.73, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetyl-N,N'-dimethyl-N'-nonanoyloxamide is sourced from PubChem (CID 54021759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).