C9H21NO — CID 160907901
methane;N,N,4-trimethylpentanamide (PubChem CID 160907901) has the molecular formula C9H21NO and a molecular weight of 159.27 g/mol. Its IUPAC name is methane;N,N,4-trimethylpentanamide.
| Compound Name | methane;N,N,4-trimethylpentanamide |
|---|---|
| PubChem CID | 160907901 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | methane;N,N,4-trimethylpentanamide |
| SMILES | C.CC(C)CCC(=O)N(C)C |
| InChI | InChI=1S/C8H17NO.CH4/c1-7(2)5-6-8(10)9(3)4;/h7H,5-6H2,1-4H3;1H4 |
| InChIKey | SQJQEZFTSXTLBA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |