C13H26O — CID 162772851
2,8,9-trimethyldecan-5-one (PubChem CID 162772851) has the molecular formula C13H26O and a molecular weight of 198.35 g/mol. Its IUPAC name is 2,8,9-trimethyldecan-5-one.
| Compound Name | 2,8,9-trimethyldecan-5-one |
|---|---|
| PubChem CID | 162772851 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | 2,8,9-trimethyldecan-5-one |
| SMILES | CC(C)CCC(=O)CCC(C)C(C)C |
| InChI | InChI=1S/C13H26O/c1-10(2)6-8-13(14)9-7-12(5)11(3)4/h10-12H,6-9H2,1-5H3 |
| InChIKey | WYSWXXOJLUPWRT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |