C9H18O3 — CID 174799972
2,8-dihydroxynonan-5-one (PubChem CID 174799972) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is 2,8-dihydroxynonan-5-one.
| Compound Name | 2,8-dihydroxynonan-5-one |
|---|---|
| PubChem CID | 174799972 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | 2,8-dihydroxynonan-5-one |
| SMILES | CC(O)CCC(=O)CCC(C)O |
| InChI | InChI=1S/C9H18O3/c1-7(10)3-5-9(12)6-4-8(2)11/h7-8,10-11H,3-6H2,1-2H3 |
| InChIKey | QXJOOVODTUIBQR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |