C14H28O2 — CID 54387052
8-hydroxy-2,11-dimethyldodecan-5-one (PubChem CID 54387052) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 8-hydroxy-2,11-dimethyldodecan-5-one.
| Compound Name | 8-hydroxy-2,11-dimethyldodecan-5-one |
|---|---|
| PubChem CID | 54387052 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 8-hydroxy-2,11-dimethyldodecan-5-one |
| SMILES | CC(C)CCC(=O)CCC(O)CCC(C)C |
| InChI | InChI=1S/C14H28O2/c1-11(2)5-7-13(15)9-10-14(16)8-6-12(3)4/h11-13,15H,5-10H2,1-4H3 |
| InChIKey | VDZBYPRLPKYSAI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |