About 6-hydroxy-2,9-dimethyldecan-5-one
6-hydroxy-2,9-dimethyldecan-5-one (PubChem CID 44721103) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is 6-hydroxy-2,9-dimethyldecan-5-one.
Molecular Properties
| Compound Name | 6-hydroxy-2,9-dimethyldecan-5-one |
| PubChem CID | 44721103 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 6-hydroxy-2,9-dimethyldecan-5-one |
| SMILES | CC(C)CCC(=O)C(O)CCC(C)C |
| InChI | InChI=1S/C12H24O2/c1-9(2)5-7-11(13)12(14)8-6-10(3)4/h9-11,13H,5-8H2,1-4H3 |
| InChIKey | BYDYJFXRRJSNMQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-hydroxy-2,9-dimethyldecan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-2,9-dimethyldecan-5-one?
The IUPAC name of 6-hydroxy-2,9-dimethyldecan-5-one (CID 44721103) is 6-hydroxy-2,9-dimethyldecan-5-one.
What is the SMILES notation for 6-hydroxy-2,9-dimethyldecan-5-one?
The canonical SMILES for 6-hydroxy-2,9-dimethyldecan-5-one is CC(C)CCC(=O)C(O)CCC(C)C.
What is the InChIKey of 6-hydroxy-2,9-dimethyldecan-5-one?
The InChIKey is BYDYJFXRRJSNMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2/c1-9(2)5-7-11(13)12(14)8-6-10(3)4/h9-11,13H,5-8H2,1-4H3.
What are the key properties of 6-hydroxy-2,9-dimethyldecan-5-one?
6-hydroxy-2,9-dimethyldecan-5-one has a molecular weight of 200.32 g/mol, XLogP of 2.79, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-2,9-dimethyldecan-5-one is sourced from PubChem (CID 44721103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).