C11H20O3 — CID 58193316
4-hydroxy-2,8-dimethylnonane-3,7-dione (PubChem CID 58193316) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is 4-hydroxy-2,8-dimethylnonane-3,7-dione.
| Compound Name | 4-hydroxy-2,8-dimethylnonane-3,7-dione |
|---|---|
| PubChem CID | 58193316 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 4-hydroxy-2,8-dimethylnonane-3,7-dione |
| SMILES | CC(C)C(=O)CCC(O)C(=O)C(C)C |
| InChI | InChI=1S/C11H20O3/c1-7(2)9(12)5-6-10(13)11(14)8(3)4/h7-8,10,13H,5-6H2,1-4H3 |
| InChIKey | JERXMYXDRSFGIV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |