About 4-amino-2,8-dimethylnonane-3,7-dione
4-amino-2,8-dimethylnonane-3,7-dione (PubChem CID 90394699) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is 4-amino-2,8-dimethylnonane-3,7-dione.
Molecular Properties
| Compound Name | 4-amino-2,8-dimethylnonane-3,7-dione |
| PubChem CID | 90394699 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 4-amino-2,8-dimethylnonane-3,7-dione |
| SMILES | CC(C)C(=O)CCC(N)C(=O)C(C)C |
| InChI | InChI=1S/C11H21NO2/c1-7(2)10(13)6-5-9(12)11(14)8(3)4/h7-9H,5-6,12H2,1-4H3 |
| InChIKey | XRJLHTYZIQKJJK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-2,8-dimethylnonane-3,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,8-dimethylnonane-3,7-dione?
The IUPAC name of 4-amino-2,8-dimethylnonane-3,7-dione (CID 90394699) is 4-amino-2,8-dimethylnonane-3,7-dione.
What is the SMILES notation for 4-amino-2,8-dimethylnonane-3,7-dione?
The canonical SMILES for 4-amino-2,8-dimethylnonane-3,7-dione is CC(C)C(=O)CCC(N)C(=O)C(C)C.
What is the InChIKey of 4-amino-2,8-dimethylnonane-3,7-dione?
The InChIKey is XRJLHTYZIQKJJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-7(2)10(13)6-5-9(12)11(14)8(3)4/h7-9H,5-6,12H2,1-4H3.
What are the key properties of 4-amino-2,8-dimethylnonane-3,7-dione?
4-amino-2,8-dimethylnonane-3,7-dione has a molecular weight of 199.29 g/mol, XLogP of 1.54, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,8-dimethylnonane-3,7-dione is sourced from PubChem (CID 90394699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).