C11H21NO2 — CID 90394699
4-amino-2,8-dimethylnonane-3,7-dione (PubChem CID 90394699) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 4-amino-2,8-dimethylnonane-3,7-dione.
| Compound Name | 4-amino-2,8-dimethylnonane-3,7-dione |
|---|---|
| PubChem CID | 90394699 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 4-amino-2,8-dimethylnonane-3,7-dione |
| SMILES | CC(C)C(=O)CCC(N)C(=O)C(C)C |
| InChI | InChI=1S/C11H21NO2/c1-7(2)10(13)6-5-9(12)11(14)8(3)4/h7-9H,5-6,12H2,1-4H3 |
| InChIKey | XRJLHTYZIQKJJK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |