About (2S)-2,6-dimethyl-5-oxoheptanal
(2S)-2,6-dimethyl-5-oxoheptanal (PubChem CID 10511104) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is (2S)-2,6-dimethyl-5-oxoheptanal.
Molecular Properties
| Compound Name | (2S)-2,6-dimethyl-5-oxoheptanal |
| PubChem CID | 10511104 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (2S)-2,6-dimethyl-5-oxoheptanal |
| SMILES | CC(C=O)CCC(=O)C(C)C |
| InChI | InChI=1S/C9H16O2/c1-7(2)9(11)5-4-8(3)6-10/h6-8H,4-5H2,1-3H3 |
| InChIKey | MKFPVXBFNKUTFE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2,6-dimethyl-5-oxoheptanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,6-dimethyl-5-oxoheptanal?
The IUPAC name of (2S)-2,6-dimethyl-5-oxoheptanal (CID 10511104) is (2S)-2,6-dimethyl-5-oxoheptanal.
What is the SMILES notation for (2S)-2,6-dimethyl-5-oxoheptanal?
The canonical SMILES for (2S)-2,6-dimethyl-5-oxoheptanal is CC(C=O)CCC(=O)C(C)C.
What is the InChIKey of (2S)-2,6-dimethyl-5-oxoheptanal?
The InChIKey is MKFPVXBFNKUTFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-7(2)9(11)5-4-8(3)6-10/h6-8H,4-5H2,1-3H3.
What are the key properties of (2S)-2,6-dimethyl-5-oxoheptanal?
(2S)-2,6-dimethyl-5-oxoheptanal has a molecular weight of 156.22 g/mol, XLogP of 1.83, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,6-dimethyl-5-oxoheptanal is sourced from PubChem (CID 10511104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).