About 2-methyl-6-oxoheptanal
2-methyl-6-oxoheptanal (PubChem CID 14561323) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is 2-methyl-6-oxoheptanal.
Molecular Properties
| Compound Name | 2-methyl-6-oxoheptanal |
| PubChem CID | 14561323 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 2-methyl-6-oxoheptanal |
| SMILES | CC(=O)CCCC(C)C=O |
| InChI | InChI=1S/C8H14O2/c1-7(6-9)4-3-5-8(2)10/h6-7H,3-5H2,1-2H3 |
| InChIKey | KPDKSDHXZBWZDL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-6-oxoheptanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-oxoheptanal?
The IUPAC name of 2-methyl-6-oxoheptanal (CID 14561323) is 2-methyl-6-oxoheptanal.
What is the SMILES notation for 2-methyl-6-oxoheptanal?
The canonical SMILES for 2-methyl-6-oxoheptanal is CC(=O)CCCC(C)C=O.
What is the InChIKey of 2-methyl-6-oxoheptanal?
The InChIKey is KPDKSDHXZBWZDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-7(6-9)4-3-5-8(2)10/h6-7H,3-5H2,1-2H3.
What are the key properties of 2-methyl-6-oxoheptanal?
2-methyl-6-oxoheptanal has a molecular weight of 142.20 g/mol, XLogP of 1.58, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-oxoheptanal is sourced from PubChem (CID 14561323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).