C17H30O3 — CID 57233861
2,13,13-trimethyl-6,12-dioxotetradecanal (PubChem CID 57233861) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is 2,13,13-trimethyl-6,12-dioxotetradecanal.
| Compound Name | 2,13,13-trimethyl-6,12-dioxotetradecanal |
|---|---|
| PubChem CID | 57233861 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 2,13,13-trimethyl-6,12-dioxotetradecanal |
| SMILES | CC(C=O)CCCC(=O)CCCCCC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H30O3/c1-14(13-18)9-8-11-15(19)10-6-5-7-12-16(20)17(2,3)4/h13-14H,5-12H2,1-4H3 |
| InChIKey | JFTZDYIOCVEXGR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|