C13H23IO2 — CID 157286345
1-iodo-10,10-dimethylundecane-2,9-dione (PubChem CID 157286345) has the molecular formula C13H23IO2 and a molecular weight of 338.23 g/mol. Its IUPAC name is 1-iodo-10,10-dimethylundecane-2,9-dione.
| Compound Name | 1-iodo-10,10-dimethylundecane-2,9-dione |
|---|---|
| PubChem CID | 157286345 |
| Molecular Formula | C13H23IO2 |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 1-iodo-10,10-dimethylundecane-2,9-dione |
| SMILES | CC(C)(C)C(=O)CCCCCCC(=O)CI |
| InChI | InChI=1S/C13H23IO2/c1-13(2,3)12(16)9-7-5-4-6-8-11(15)10-14/h4-10H2,1-3H3 |
| InChIKey | HVNJYRFDJNXVAL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|