C14H29NO — CID 58895617
8-(tert-butylamino)-2,2-dimethyloctan-3-one (PubChem CID 58895617) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is 8-(tert-butylamino)-2,2-dimethyloctan-3-one.
| Compound Name | 8-(tert-butylamino)-2,2-dimethyloctan-3-one |
|---|---|
| PubChem CID | 58895617 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 8-(tert-butylamino)-2,2-dimethyloctan-3-one |
| SMILES | CC(C)(C)NCCCCCC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H29NO/c1-13(2,3)12(16)10-8-7-9-11-15-14(4,5)6/h15H,7-11H2,1-6H3 |
| InChIKey | KJSHXRVKAWPGMD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|