C15H31NO2 — CID 90364505
2,2-dimethylpropyl 6-(tert-butylamino)hexanoate (PubChem CID 90364505) has the molecular formula C15H31NO2 and a molecular weight of 257.42 g/mol. Its IUPAC name is 2,2-dimethylpropyl 6-(tert-butylamino)hexanoate.
| Compound Name | 2,2-dimethylpropyl 6-(tert-butylamino)hexanoate |
|---|---|
| PubChem CID | 90364505 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | 2,2-dimethylpropyl 6-(tert-butylamino)hexanoate |
| SMILES | CC(C)(C)COC(=O)CCCCCNC(C)(C)C |
| InChI | InChI=1S/C15H31NO2/c1-14(2,3)12-18-13(17)10-8-7-9-11-16-15(4,5)6/h16H,7-12H2,1-6H3 |
| InChIKey | KHAYOXFBUCPBOW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|