C17H32O3 — CID 158079491
11,11-dimethyl-1-propan-2-yloxydodecane-2,10-dione (PubChem CID 158079491) has the molecular formula C17H32O3 and a molecular weight of 284.44 g/mol. Its IUPAC name is 11,11-dimethyl-1-propan-2-yloxydodecane-2,10-dione.
| Compound Name | 11,11-dimethyl-1-propan-2-yloxydodecane-2,10-dione |
|---|---|
| PubChem CID | 158079491 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | 11,11-dimethyl-1-propan-2-yloxydodecane-2,10-dione |
| SMILES | CC(C)OCC(=O)CCCCCCCC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H32O3/c1-14(2)20-13-15(18)11-9-7-6-8-10-12-16(19)17(3,4)5/h14H,6-13H2,1-5H3 |
| InChIKey | FMTWAWQDIALUOF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|