C16H30O3 — CID 148963643
6-(5,5-dimethyl-4-oxohexoxy)-2,2-dimethylhexan-3-one (PubChem CID 148963643) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is 6-(5,5-dimethyl-4-oxohexoxy)-2,2-dimethylhexan-3-one.
| Compound Name | 6-(5,5-dimethyl-4-oxohexoxy)-2,2-dimethylhexan-3-one |
|---|---|
| PubChem CID | 148963643 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 6-(5,5-dimethyl-4-oxohexoxy)-2,2-dimethylhexan-3-one |
| SMILES | CC(C)(C)C(=O)CCCOCCCC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H30O3/c1-15(2,3)13(17)9-7-11-19-12-8-10-14(18)16(4,5)6/h7-12H2,1-6H3 |
| InChIKey | PSHRVTXRCKCKCC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|