C17H32O3S2 — CID 148770166
1-[6-(tert-butyldisulfanyl)-4-oxohexoxy]-4,4-dimethylpentan-3-one (PubChem CID 148770166) has the molecular formula C17H32O3S2 and a molecular weight of 348.57 g/mol. Its IUPAC name is 1-[6-(tert-butyldisulfanyl)-4-oxohexoxy]-4,4-dimethylpentan-3-one.
| Compound Name | 1-[6-(tert-butyldisulfanyl)-4-oxohexoxy]-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 148770166 |
| Molecular Formula | C17H32O3S2 |
| Molecular Weight | 348.57 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-[6-(tert-butyldisulfanyl)-4-oxohexoxy]-4,4-dimethylpentan-3-one |
| SMILES | CC(C)(C)SSCCC(=O)CCCOCCC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H32O3S2/c1-16(2,3)15(19)9-12-20-11-7-8-14(18)10-13-21-22-17(4,5)6/h7-13H2,1-6H3 |
| InChIKey | OIGCVNLLGRMNTG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|