C14H26O2S2 — CID 118403333
1-[(4,4-dimethyl-3-oxopentyl)disulfanyl]-4,4-dimethylpentan-3-one (PubChem CID 118403333) has the molecular formula C14H26O2S2 and a molecular weight of 290.49 g/mol. Its IUPAC name is 1-[(4,4-dimethyl-3-oxopentyl)disulfanyl]-4,4-dimethylpentan-3-one.
| Compound Name | 1-[(4,4-dimethyl-3-oxopentyl)disulfanyl]-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 118403333 |
| Molecular Formula | C14H26O2S2 |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 1-[(4,4-dimethyl-3-oxopentyl)disulfanyl]-4,4-dimethylpentan-3-one |
| SMILES | CC(C)(C)C(=O)CCSSCCC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H26O2S2/c1-13(2,3)11(15)7-9-17-18-10-8-12(16)14(4,5)6/h7-10H2,1-6H3 |
| InChIKey | WMOSFDGBQUHIQK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|